Difference between revisions of "Pi"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14456 == * left end position: ** 717 * transcription direction: ** NEGATIVE * right end position: ** 4528 * centisome position: ** 12.70150...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] == * smiles: ** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N |
− | * | + | * common name: |
− | ** | + | ** all-trans-3,4-didehydrolycopene |
− | * | + | * molecular weight: |
− | ** | + | ** 534.867 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3,4-dehydrolycopene | ||
+ | ** 3,4-didehydrolycopene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11999]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061227 16061227] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.17220904.html 17220904] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62474 62474] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15867 C15867] | ||
+ | {{#set: smiles=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C}} | ||
+ | {{#set: inchi key=InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N}} | ||
+ | {{#set: common name=all-trans-3,4-didehydrolycopene}} | ||
+ | {{#set: molecular weight=534.867 }} | ||
+ | {{#set: common name=3,4-dehydrolycopene|3,4-didehydrolycopene}} | ||
+ | {{#set: consumed by=RXN-11999}} |
Revision as of 18:55, 18 March 2018
Contents
Metabolite CPD-12932
- smiles:
- CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C
- inchi key:
- InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N
- common name:
- all-trans-3,4-didehydrolycopene
- molecular weight:
- 534.867
- Synonym(s):
- 3,4-dehydrolycopene
- 3,4-didehydrolycopene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links