Difference between revisions of "Tiso gene 19031"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.16.4-RXN 3.4.16.4-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-lactamase * ec n...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] == * smiles: ** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2) * inchi key: ** InC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.16.4-RXN 3.4.16.4-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)
 +
* inchi key:
 +
** InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** beta-lactamase
+
** 7-carboxy-7-deazaguanine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.4.16.4 EC-3.4.16.4]
+
** 193.141   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12093]]
−
** 1 [[WATER]][c] '''+''' 1 [[NAcMur-Peptide-NAcGlc-Undecaprenols]][c] '''=>''' 1 [[D-ALANINE]][c] '''+''' 1 [[NAcMur-4Peptide-NAcGlc-Undecaprenols]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 a lipid II[c] '''=>''' 1 D-alanine[c] '''+''' 1 a N-acetylglucosamine--N-acetylmuramyl-(tetrapeptide) pyrophosphoryl-undecaprenol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18870]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P24228 P24228]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852357 49852357]
−
** [http://www.uniprot.org/uniprot/P38422 P38422]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q9JUX6 Q9JUX6]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61036 61036]
−
** [http://www.uniprot.org/uniprot/P08506 P08506]
+
{{#set: smiles=C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)}}
−
** [http://www.uniprot.org/uniprot/Q9Z7N2 Q9Z7N2]
+
{{#set: inchi key=InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/P44466 P44466]
+
{{#set: common name=7-carboxy-7-deazaguanine}}
−
** [http://www.uniprot.org/uniprot/Q53613 Q53613]
+
{{#set: molecular weight=193.141    }}
−
** [http://www.uniprot.org/uniprot/Q05523 Q05523]
+
{{#set: consumed by=RXN-12093}}
−
** [http://www.uniprot.org/uniprot/P39042 P39042]
+
−
** [http://www.uniprot.org/uniprot/Q59439 Q59439]
+
−
** [http://www.uniprot.org/uniprot/P35150 P35150]
+
−
** [http://www.uniprot.org/uniprot/P15555 P15555]
+
−
** [http://www.uniprot.org/uniprot/P08750 P08750]
+
−
** [http://www.uniprot.org/uniprot/P0AEB2 P0AEB2]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=beta-lactamase}}
+
−
{{#set: ec number=EC-3.4.16.4}}
+
−
{{#set: gene associated=Tiso_gene_18870}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 18:55, 18 March 2018

Metabolite CPD-13043

  • smiles:
    • C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)
  • inchi key:
    • InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M
  • common name:
    • 7-carboxy-7-deazaguanine
  • molecular weight:
    • 193.141
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19031&oldid=27797"