Difference between revisions of "Tiso gene 14816"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15652 == * Synonym(s): == Reactions associated == * 2.7.10.1-RXN ** pantograph-esiliculosus * 3.6.4.4-RXN ** [[pantograph]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == |
+ | * smiles: | ||
+ | ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O | ||
+ | * inchi key: | ||
+ | ** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L | ||
+ | * common name: | ||
+ | ** GDP-β-L-gulose | ||
+ | * molecular weight: | ||
+ | ** 603.329 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[RXN-7772]] |
− | + | * [[RXN-7771]] | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925] | ||
+ | {{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}} | ||
+ | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}} | ||
+ | {{#set: common name=GDP-β-L-gulose}} | ||
+ | {{#set: molecular weight=603.329 }} | ||
+ | {{#set: reversible reaction associated=RXN-7772|RXN-7771}} |
Revision as of 19:55, 18 March 2018
Contents
Metabolite CPD-7078
- smiles:
- C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
- common name:
- GDP-β-L-gulose
- molecular weight:
- 603.329
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O" cannot be used as a page name in this wiki.