Difference between revisions of "Tiso gene 20095"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6547 == * left end position: ** 2533 * transcription direction: ** POSITIVE * right end position: ** 2813 * centisome position: ** 20.99287...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_6547 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] ==
−
* left end position:
+
* smiles:
−
** 2533
+
** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N
−
* right end position:
+
* common name:
−
** 2813
+
** 3',5'-diiodothyronine
−
* centisome position:
+
* molecular weight:
−
** 20.992872    
+
** 525.081    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3',5'-diiodo-L-thyronine
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]]
+
* [[RXN-12037]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2533}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986088 50986088]
−
{{#set: right end position=2813}}
+
{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O}}
−
{{#set: centisome position=20.992872   }}
+
{{#set: inchi key=InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N}}
−
{{#set: reaction associated=DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN}}
+
{{#set: common name=3',5'-diiodothyronine}}
 +
{{#set: molecular weight=525.081   }}
 +
{{#set: common name=3',5'-diiodo-L-thyronine}}
 +
{{#set: consumed by=RXN-12037}}

Revision as of 19:56, 18 March 2018

Metabolite CPD-13008

  • smiles:
    • C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O
  • inchi key:
    • InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N
  • common name:
    • 3',5'-diiodothyronine
  • molecular weight:
    • 525.081
  • Synonym(s):
    • 3',5'-diiodo-L-thyronine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_20095&oldid=27885"