Difference between revisions of "CPD-12175"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * inchi key: ** InChIKey=ZNJFBWY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-29-C48-2-ACPs cis-cis-D11-29-C48-2-ACPs] == * common name: ** a cis,cis-delta11,29-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-29-C48-2-ACPs cis-cis-D11-29-C48-2-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a cis,cis-delta11,29-C48:2-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1G-915]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a cis,cis-delta11,29-C48:2-[acp]}} | |
| − | + | {{#set: produced by=RXN1G-915}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: produced by= | + | |
Revision as of 18:56, 18 March 2018
Contents
Metabolite cis-cis-D11-29-C48-2-ACPs
- common name:
- a cis,cis-delta11,29-C48:2-[acp]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a cis,cis-delta11,29-C48:2-[acp" cannot be used as a page name in this wiki.
