Difference between revisions of "Tiso gene 10094"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_1672 == * left end position: ** 1684 * transcription direction: ** POSITIVE * right end position: ** 9013 * centisome position: ** 7.559705...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_1672 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
−
* left end position:
+
* smiles:
−
** 1684
+
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
−
* right end position:
+
* common name:
−
** 9013
+
** XLLG xyloglucan oligosaccharide
−
* centisome position:
+
* molecular weight:
−
** 7.5597057    
+
** 1387.215    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN-12400]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1684}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
−
{{#set: right end position=9013}}
+
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
−
{{#set: centisome position=7.5597057   }}
+
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
−
{{#set: reaction associated=ATPASE-RXN}}
+
{{#set: common name=XLLG xyloglucan oligosaccharide}}
 +
{{#set: molecular weight=1387.215   }}
 +
{{#set: consumed by=RXN-12400}}

Revision as of 18:58, 18 March 2018

Metabolite CPD-13378

  • smiles:
    • C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
  • inchi key:
    • InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
  • common name:
    • XLLG xyloglucan oligosaccharide
  • molecular weight:
    • 1387.215
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10094&oldid=28041"