Difference between revisions of "Tiso gene 8820"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-phospho-L-histidines Protein-phospho-L-histidines] == * common name: ** a [protein]-N-p...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-phospho-L-histidines Protein-phospho-L-histidines] ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
+
* inchi key:
+
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
+
 
* common name:
 
* common name:
** XTP
+
** a [protein]-N-phospho-L-histidine
* molecular weight:
+
** 520.136   
+
 
* Synonym(s):
 
* Synonym(s):
** xanthosine 5' triphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-1603]]
 
* [[NTPD]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.13.3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a [protein]-N-phospho-L-histidine}}
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
+
{{#set: produced by=2.7.13.3-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
+
* BIGG : xtp
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
+
* HMDB : HMDB00293
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
+
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
+
{{#set: common name=XTP}}
+
{{#set: molecular weight=520.136    }}
+
{{#set: common name=xanthosine 5' triphosphate}}
+
{{#set: consumed by=RXN0-1603|NTPD}}
+

Revision as of 18:58, 18 March 2018

Metabolite Protein-phospho-L-histidines

  • common name:
    • a [protein]-N-phospho-L-histidine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-N-phospho-L-histidine" cannot be used as a page name in this wiki.