Difference between revisions of "Tiso gene 7932"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucomannans Glucomannans] == * common name: ** a glucomannan * Synonym(s): == Reaction(s) kno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYL-MALONYL-COA METHYL-MALONYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYL-MALONYL-COA METHYL-MALONYL-COA] == |
| + | * smiles: | ||
| + | ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=MZFOKIKEPGUZEN-AGCMQPJKSA-I | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-methylmalonyl-CoA |
| + | * molecular weight: | ||
| + | ** 862.568 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-methylmalonyl-CoA | ||
| + | ** methylmalonyl-CoA | ||
| + | ** methyl-malonyl-coenzyme A | ||
| + | ** CH3-malonyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[METHYLMALONYL-COA-MUT-RXN]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01213 C01213] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57326 57326] | ||
| + | * METABOLIGHTS : MTBLC57326 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266560 45266560] | ||
| + | * BIGG : mmcoa__R | ||
| + | {{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=MZFOKIKEPGUZEN-AGCMQPJKSA-I}} | ||
| + | {{#set: common name=(R)-methylmalonyl-CoA}} | ||
| + | {{#set: molecular weight=862.568 }} | ||
| + | {{#set: common name=L-methylmalonyl-CoA|methylmalonyl-CoA|methyl-malonyl-coenzyme A|CH3-malonyl-CoA}} | ||
| + | {{#set: reversible reaction associated=METHYLMALONYL-COA-MUT-RXN}} | ||
Revision as of 18:58, 18 March 2018
Contents
Metabolite METHYL-MALONYL-COA
- smiles:
- CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O
- inchi key:
- InChIKey=MZFOKIKEPGUZEN-AGCMQPJKSA-I
- common name:
- (R)-methylmalonyl-CoA
- molecular weight:
- 862.568
- Synonym(s):
- L-methylmalonyl-CoA
- methylmalonyl-CoA
- methyl-malonyl-coenzyme A
- CH3-malonyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O" cannot be used as a page name in this wiki.
