Difference between revisions of "Tiso gene 9733"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-LYSOPHOSPHATIDATE L-1-LYSOPHOSPHATIDATE] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * smiles: ** C12(NC(=O)NC(C=1N=CN2)=O) * inchi key: ** InChIKey=LRFVTYWOQ...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C12(NC(=O)NC(C=1N=CN2)=O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=LRFVTYWOQMYALW-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** xanthine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 152.112 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2,6-dioxopurine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[XANTHINE-OXIDASE-RXN]] |
| + | * [[XANPRIBOSYLTRAN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7682]] |
| − | * [[ | + | * [[RXN0-363]] |
| − | * [[ | + | * [[XANTHOSINEPHOSPHORY-RXN]] |
| − | * [[ | + | * [[GUANINE-DEAMINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN0-901]] | ||
== External links == | == External links == | ||
| + | * CAS : 69-89-6 | ||
| + | * METABOLIGHTS : MTBLC17712 | ||
| + | * DRUGBANK : DB02134 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1188 1188] |
| + | * HMDB : HMDB00292 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00385 C00385] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.1151.html 1151] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17712 17712] |
| − | * | + | * BIGG : xan |
| − | {{#set: smiles= | + | {{#set: smiles=C12(NC(=O)NC(C=1N=CN2)=O)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=LRFVTYWOQMYALW-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=xanthine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=152.112 }} |
| − | {{#set: common name= | + | {{#set: common name=2,6-dioxopurine}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=XANTHINE-OXIDASE-RXN|XANPRIBOSYLTRAN-RXN}} |
| − | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-7682|RXN0-363|XANTHOSINEPHOSPHORY-RXN|GUANINE-DEAMINASE-RXN}} |
| + | {{#set: reversible reaction associated=RXN0-901}} | ||
Revision as of 19:59, 18 March 2018
Contents
Metabolite XANTHINE
- smiles:
- C12(NC(=O)NC(C=1N=CN2)=O)
- inchi key:
- InChIKey=LRFVTYWOQMYALW-UHFFFAOYSA-N
- common name:
- xanthine
- molecular weight:
- 152.112
- Synonym(s):
- 2,6-dioxopurine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 69-89-6
- METABOLIGHTS : MTBLC17712
- DRUGBANK : DB02134
- PUBCHEM:
- HMDB : HMDB00292
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : xan
