Difference between revisions of "RXN-12625"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12533 == * left end position: ** 3857 * transcription direction: ** POSITIVE * right end position: ** 6912 * centisome position: ** 55.7450...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12533 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
* left end position:
+
* smiles:
** 3857
+
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
* right end position:
+
* common name:
** 6912
+
** 8-oxo-dGMP
* centisome position:
+
* molecular weight:
** 55.74505    
+
** 361.207    
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-7,8-dihydro-2'-dGMP
 +
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
 +
** 8-oxo-deoxyguanosine-monophosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GDR]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[creinhardtii]]
+
== Reaction(s) of unknown directionality ==
* [[GDR_nadp]]
+
* [[RXN-14205]]
** [[pantograph]]-[[creinhardtii]]
+
* [[GDR_nadp_h]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[GDR_nadp_m]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[GDRh]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[GDRm]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-4081]]
+
* [[GLUT-REDOX-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3857}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
{{#set: right end position=6912}}
+
* CHEBI:
{{#set: centisome position=55.74505   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
{{#set: reaction associated=GDR|GDR_nadp|GDR_nadp_h|GDR_nadp_m|GDRh|GDRm|GLUTATHIONE-REDUCT-NADPH-RXN}}
+
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
{{#set: pathway associated=PWY-4081|GLUT-REDOX-PWY}}
+
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
 +
{{#set: common name=8-oxo-dGMP}}
 +
{{#set: molecular weight=361.207   }}
 +
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
 +
{{#set: reversible reaction associated=RXN-14205}}

Revision as of 19:59, 18 March 2018

Metabolite CPD-12365

  • smiles:
    • C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
  • common name:
    • 8-oxo-dGMP
  • molecular weight:
    • 361.207
  • Synonym(s):
    • 8-oxo-7,8-dihydro-2'-dGMP
    • 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
    • 8-oxo-deoxyguanosine-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.