Difference between revisions of "RXN-17609"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([N+])CCCC([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O |
* common name: | * common name: | ||
| − | ** | + | ** L-lysine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 147.197 |
* Synonym(s): | * Synonym(s): | ||
| + | ** K | ||
| + | ** lysine | ||
| + | ** L-lys | ||
| + | ** lys | ||
| + | ** 2,6-diaminohexanoic acid | ||
| + | ** lysine acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RME144]] |
| + | * [[LYSINE--TRNA-LIGASE-RXN]] | ||
| + | * [[LYSDECARBOX-RXN]] | ||
| + | * [[1.5.1.8-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.5.1.7-RXN]] | ||
| + | * [[DIAMINOPIMDECARB-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 56-87-1 | ||
| + | * METABOLIGHTS : MTBLC32551 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460926 5460926] |
| − | {{#set: smiles= | + | * HMDB : HMDB00182 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00047 C00047] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: consumed by=RXN- | + | ** [http://www.chemspider.com/Chemical-Structure.5747.html 5747] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32551 32551] | ||
| + | * BIGG : lys__L | ||
| + | * BIGG : 33655 | ||
| + | {{#set: smiles=C([N+])CCCC([N+])C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O}} | ||
| + | {{#set: common name=L-lysine}} | ||
| + | {{#set: molecular weight=147.197 }} | ||
| + | {{#set: common name=K|lysine|L-lys|lys|2,6-diaminohexanoic acid|lysine acid}} | ||
| + | {{#set: consumed by=RME144|LYSINE--TRNA-LIGASE-RXN|LYSDECARBOX-RXN|1.5.1.8-RXN}} | ||
| + | {{#set: produced by=1.5.1.7-RXN|DIAMINOPIMDECARB-RXN}} | ||
Revision as of 18:59, 18 March 2018
Contents
Metabolite LYS
- smiles:
- C([N+])CCCC([N+])C([O-])=O
- inchi key:
- InChIKey=KDXKERNSBIXSRK-YFKPBYRVSA-O
- common name:
- L-lysine
- molecular weight:
- 147.197
- Synonym(s):
- K
- lysine
- L-lys
- lys
- 2,6-diaminohexanoic acid
- lysine acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 56-87-1
- METABOLIGHTS : MTBLC32551
- PUBCHEM:
- HMDB : HMDB00182
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : lys__L
- BIGG : 33655
"C([N+])CCCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
