Difference between revisions of "RXN-11667"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4497 == * Synonym(s): == Reactions associated == * ACID-PHOSPHATASE-RXN ** pantograph-esiliculosus * RXNQT-4191 ** panto...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_4497 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] ==
 +
* smiles:
 +
** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
 +
* inchi key:
 +
** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
 +
* common name:
 +
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
 +
* molecular weight:
 +
** 223.234   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ACID-PHOSPHATASE-RXN]]
+
* [[RXN-15733]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
* [[RXNQT-4191]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-6348]]
+
* [[PWY-6907]]
+
* [[PWY-6908]]
+
* [[PWY-7356]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=ACID-PHOSPHATASE-RXN|RXNQT-4191}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6348|PWY-6907|PWY-6908|PWY-7356}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804]
 +
{{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}}
 +
{{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}}
 +
{{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
 +
{{#set: molecular weight=223.234    }}
 +
{{#set: consumed by=RXN-15733}}

Revision as of 20:00, 18 March 2018

Metabolite CPD-16953

  • smiles:
    • CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
  • inchi key:
    • InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
  • common name:
    • 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
  • molecular weight:
    • 223.234
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links


"2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" cannot be used as a page name in this wiki.