Difference between revisions of "RXN1G-469"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == * direction: ** REVERSIBLE * common name: ** galactose-3-o-sulfotransferase...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] ==
* smiles:
+
* direction:
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
+
 
* common name:
 
* common name:
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
+
** galactose-3-o-sulfotransferase_2-like
* molecular weight:
+
* ec number:
** 412.698   
+
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
 
* Synonym(s):
 
* Synonym(s):
** 5α-cholesta-8,24-dien-3β-ol
 
** 4α,14α-dimethylzymosterol
 
** 29-norlanosterol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-11881]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PAPS]][c] '''+''' 1 [[1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol]][c] '''<=>''' 1 [[Seminolipids]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 a 1-O-alkyl-2-O-acyl-3-O-&beta;-D-galactosyl-sn-glycerol[c] '''<=>''' 1 a seminolipid[c] '''+''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13030]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557]
+
{{#set: common name=galactose-3-o-sulfotransferase_2-like}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: ec number=EC-2.8.2.11}}
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
+
{{#set: gene associated=Tiso_gene_13030}}
{{#set: common name=4&alpha;,14&alpha;-dimethyl-5&alpha;-cholesta-8,24-dien-3&beta;-ol}}
+
{{#set: in pathway=}}
{{#set: molecular weight=412.698    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=5&alpha;-cholesta-8,24-dien-3&beta;-ol|4&alpha;,14&alpha;-dimethylzymosterol|29-norlanosterol}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: consumed by=RXN-11881}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 01:02, 19 March 2018

Reaction RXN-17203

  • direction:
    • REVERSIBLE
  • common name:
    • galactose-3-o-sulfotransferase_2-like
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links