Difference between revisions of "Tiso gene 3751"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_7932 == * Synonym(s): == Reactions associated == * 2.7.11.22-RXN ** pantograph-esiliculosus * PROTEIN-KINASE-RXN ** pant...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_7932 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * [[2.7.11.22-RXN]] |
| − | + | ** [[pantograph]]-[[esiliculosus]] | |
| − | == | + | * [[PROTEIN-KINASE-RXN]] |
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=2.7.11.22-RXN|PROTEIN-KINASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 00:04, 19 March 2018
Gene Tiso_gene_7932
- Synonym(s):
