Difference between revisions of "RXN-13431"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_16153 == * left end position: ** 536 * transcription direction: ** POSITIVE * right end position: ** 4458 * centisome position: ** 11.78281...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16153 == |
− | * | + | * left end position: |
− | ** | + | ** 536 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4458 |
− | * | + | * centisome position: |
− | ** | + | ** 11.782810 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | == | + | * [[GLYOHMETRANS-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | * [[ | + | ** experimental_annotation |
− | * [[ | + | ***ec-number |
− | * [[ | + | * [[RXN0-5234]] |
− | * [[ | + | ** experimental_annotation |
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-2161]] | ||
+ | * [[PWY-1622]] | ||
+ | * [[PWY-3841]] | ||
+ | * [[1CMET2-PWY]] | ||
+ | * [[PWY-3661]] | ||
+ | * [[GLYSYN-PWY]] | ||
+ | * [[PWY-5497]] | ||
+ | * [[PWY-2201]] | ||
+ | * [[PWY-181]] | ||
+ | * [[PWY-3661-1]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=536}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4458}} | |
− | + | {{#set: centisome position=11.782810 }} | |
− | + | {{#set: reaction associated=GLYOHMETRANS-RXN|RXN0-5234}} | |
− | + | {{#set: pathway associated=PWY-2161|PWY-1622|PWY-3841|1CMET2-PWY|PWY-3661|GLYSYN-PWY|PWY-5497|PWY-2201|PWY-181|PWY-3661-1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 00:10, 19 March 2018
Gene Tiso_gene_16153
- left end position:
- 536
- transcription direction:
- POSITIVE
- right end position:
- 4458
- centisome position:
- 11.782810
- Synonym(s):
Reactions associated
- GLYOHMETRANS-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN0-5234
- experimental_annotation
- automated-name-match
- experimental_annotation