Difference between revisions of "Tiso gene 5022"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_3359 == * left end position: ** 15139 * transcription direction: ** NEGATIVE * right end position: ** 16461 * centisome position: ** 89.484...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3359 == |
− | * | + | * left end position: |
− | ** | + | ** 15139 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 16461 |
− | * | + | * centisome position: |
− | ** | + | ** 89.48457 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]] | |
− | * [[RXN- | + | ** in-silico_annotation |
− | == | + | ***automated-name-match |
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-4041]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=15139}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=16461}} | |
− | + | {{#set: centisome position=89.48457 }} | |
− | {{#set: | + | {{#set: reaction associated=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-4041}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 01:11, 19 March 2018
Gene Tiso_gene_3359
- left end position:
- 15139
- transcription direction:
- NEGATIVE
- right end position:
- 16461
- centisome position:
- 89.48457
- Synonym(s):
Reactions associated
- 5-OXOPROLINASE-ATP-HYDROLYSING-RXN
- in-silico_annotation
- automated-name-match
- pantograph-athaliana
- pantograph-esiliculosus
- pantograph-creinhardtii
- in-silico_annotation