Difference between revisions of "Tiso gene 5022"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...")
(Created page with "Category:Gene == Gene Tiso_gene_3359 == * left end position: ** 15139 * transcription direction: ** NEGATIVE * right end position: ** 16461 * centisome position: ** 89.484...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
+
== Gene Tiso_gene_3359 ==
* smiles:
+
* left end position:
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
+
** 15139
* inchi key:
+
* transcription direction:
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
+
** NEGATIVE
* common name:
+
* right end position:
** serotonin O-sulfate
+
** 16461
* molecular weight:
+
* centisome position:
** 256.276    
+
** 89.48457    
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxytryptamine O-sulfate
 
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
* [[RXN-10777]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-4041]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=15139}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
+
{{#set: transcription direction=NEGATIVE}}
* CHEMSPIDER:
+
{{#set: right end position=16461}}
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
+
{{#set: centisome position=89.48457   }}
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
+
{{#set: reaction associated=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}}
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
+
{{#set: pathway associated=PWY-4041}}
{{#set: common name=serotonin O-sulfate}}
+
{{#set: molecular weight=256.276   }}
+
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
+
{{#set: produced by=RXN-10777}}
+

Revision as of 01:11, 19 March 2018

Gene Tiso_gene_3359

  • left end position:
    • 15139
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 16461
  • centisome position:
    • 89.48457
  • Synonym(s):

Reactions associated

Pathways associated

External links