Difference between revisions of "Tiso gene 9916"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == * smiles: ** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SEDOBISALDOL-RXN SEDOBISALDOL-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.exp...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SEDOBISALDOL-RXN SEDOBISALDOL-RXN] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J
+
** [http://enzyme.expasy.org/EC/4.1.2 EC-4.1.2]
−
* common name:
+
−
** (2E,9Z)-octadecenoyl-CoA
+
−
* molecular weight:
+
−
** 1025.937   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 18:2-Δ2,Δ9-CoA
 
−
** 2-trans,9-cis-octadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-17775]]
+
** 1 [[ERYTHROSE-4P]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''<=>''' 1 [[D-SEDOHEPTULOSE-1-7-P2]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 D-erythrose 4-phosphate[c] '''+''' 1 glycerone phosphate[c] '''<=>''' 1 D-sedoheptulose-1,7-bisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_9179]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_12272]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_14568]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_65]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
* [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
 +
** '''13''' reactions found over '''13''' reactions in the full pathway
 +
* [[PWY0-1517]], sedoheptulose bisphosphate bypass: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1517 PWY0-1517]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* RHEA:
−
{{#set: inchi key=InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30167 30167]
−
{{#set: common name=(2E,9Z)-octadecenoyl-CoA}}
+
* LIGAND-RXN:
−
{{#set: molecular weight=1025.937    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?R01829 R01829]
−
{{#set: common name=18:2-&Delta;2,&Delta;9-CoA|2-trans,9-cis-octadecenoyl-CoA}}
+
{{#set: direction=REVERSIBLE}}
−
{{#set: produced by=RXN-17775}}
+
{{#set: ec number=EC-4.1.2}}
 +
{{#set: gene associated=Tiso_gene_9179|Tiso_gene_12272|Tiso_gene_14568|Tiso_gene_65}}
 +
{{#set: in pathway=CALVIN-PWY|PWY0-1517}}
 +
{{#set: reconstruction category=orthology|manual}}
 +
{{#set: reconstruction source=manual-primary_network|orthology-athaliana|orthology-creinhardtii|orthology-synechocystis}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 00:11, 19 March 2018

Reaction SEDOBISALDOL-RXN

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • CALVIN-PWY, Calvin-Benson-Bassham cycle: CALVIN-PWY
    • 13 reactions found over 13 reactions in the full pathway
  • PWY0-1517, sedoheptulose bisphosphate bypass: PWY0-1517
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9916&oldid=29115"