Difference between revisions of "TRNA-uridine-38-40"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] == * smiles: ** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATP_3h_tm ATP_3h_tm] == * direction: ** LEFT-TO-RIGHT * common name: ** ADP/ATP transporter, mitoch...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15676 CPD-15676] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATP_3h_tm ATP_3h_tm] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J
+
 
* common name:
 
* common name:
−
** 6-trans-3-oxo-tridecenoyl-CoA
+
** ADP/ATP transporter, mitochondrial
−
* molecular weight:
+
−
** 971.802   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6E-3-oxo-tridecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14788]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 3.0 [[PROTON]][m] '''+''' 1.0 [[ADP]][m] '''=>''' 1.0 [[ADP]][c] '''+''' 3.0 [[PROTON]][c] '''+''' 1.0 [[ATP]][m]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 3.0 H+[m] '''+''' 1.0 ADP[m] '''=>''' 1.0 ADP[c] '''+''' 3.0 H+[c] '''+''' 1.0 ATP[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2553]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657406 90657406]
+
{{#set: common name=ADP/ATP transporter, mitochondrial}}
−
{{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_2553}}
−
{{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-HMXWSVNBSA-J}}
+
{{#set: in pathway=}}
−
{{#set: common name=6-trans-3-oxo-tridecenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=971.802    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=6E-3-oxo-tridecenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-14788}}
+

Revision as of 01:12, 19 March 2018

Reaction ATP_3h_tm

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ADP/ATP transporter, mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 3.0 H+[m] + 1.0 ADP[m] => 1.0 ADP[c] + 3.0 H+[c] + 1.0 ATP[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-uridine-38-40&oldid=29166"