Difference between revisions of "RXN0-5254"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * smiles: ** C12(NC(=O)NC(C=1N=CN2)=O) * inchi key: ** InChIKey=LRFVTYWOQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14187 RXN-14187] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14187 RXN-14187] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.6 EC-3.6.1.6] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[DCDP]][c] '''=>''' 1 [[DCMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 dCDP[c] '''=>''' 1 dCMP[c] '''+''' 1 H+[c] '''+''' 1 phosphate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | + | * [[Tiso_gene_20236]] | |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
+ | * [[Tiso_gene_12899]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7210]], pyrimidine deoxyribonucleotides biosynthesis from CTP: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7210 PWY-7210] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: ec number=EC-3.6.1.6}} | |
− | + | {{#set: gene associated=Tiso_gene_20236|Tiso_gene_12899}} | |
− | + | {{#set: in pathway=PWY-7210}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 01:12, 19 March 2018
Contents
Reaction RXN-14187
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 dCDP[c] => 1 dCMP[c] + 1 H+[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_20236
- Tiso_gene_12899
- IN-SILICO_ANNOTATION
- EC-NUMBER
- EXPERIMENTAL_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION
Pathways
- PWY-7210, pyrimidine deoxyribonucleotides biosynthesis from CTP: PWY-7210
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation