Difference between revisions of "Tiso gene 6635"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * inchi key: ** InChIKey=L...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8350 RXN-8350] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8350 RXN-8350] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.14.19.30 EC-1.14.19.30] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[CPD-17281]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[CPD-17282]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a [glycerolipid]-icosatetraenoate[c] '''+''' 1 oxygen[c] '''+''' 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 H2O[c] '''+''' 1 a [glycerolipid]-icosapentaenoate[c] '''+''' 2 a ferricytochrome b5[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7602]], icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7602 PWY-7602] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-6958]], icosapentaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6958 PWY-6958] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.14.19.30}} | |
− | + | {{#set: in pathway=PWY-7602|PWY-6958}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 01:13, 19 March 2018
Contents
Reaction RXN-8350
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-17281[c] + 1 OXYGEN-MOLECULE[c] + 2 PROTON[c] + 2 FERROCYTOCHROME-B5[c] => 2 WATER[c] + 1 CPD-17282[c] + 2 FERRICYTOCHROME-B5[c]
- With common name(s):
- 1 a [glycerolipid]-icosatetraenoate[c] + 1 oxygen[c] + 2 H+[c] + 2 a ferrocytochrome b5[c] => 2 H2O[c] + 1 a [glycerolipid]-icosapentaenoate[c] + 2 a ferricytochrome b5[c]
Genes associated with this reaction
Pathways
- PWY-7602, icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): PWY-7602
- 7 reactions found over 7 reactions in the full pathway
- PWY-6958, icosapentaenoate biosynthesis I (lower eukaryotes): PWY-6958
- 2 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation