Difference between revisions of "RXN0-6274"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_3315 == * left end position: ** 14801 * transcription direction: ** POSITIVE * right end position: ** 16519 * centisome position: ** 86.911...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3315 == |
− | * | + | * left end position: |
− | ** | + | ** 14801 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 16519 |
− | * | + | * centisome position: |
− | ** | + | ** 86.91133 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.5.1.98-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=14801}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=16519}} |
− | {{#set: | + | {{#set: centisome position=86.91133 }} |
− | {{#set: | + | {{#set: reaction associated=3.5.1.98-RXN}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:16, 19 March 2018
Gene Tiso_gene_3315
- left end position:
- 14801
- transcription direction:
- POSITIVE
- right end position:
- 16519
- centisome position:
- 86.91133
- Synonym(s):
Reactions associated
- 3.5.1.98-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation