Difference between revisions of "RXN0-6274"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Tiso_gene_3315 == * left end position: ** 14801 * transcription direction: ** POSITIVE * right end position: ** 16519 * centisome position: ** 86.911...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] ==
+
== Gene Tiso_gene_3315 ==
* smiles:
+
* left end position:
** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
+
** 14801
* inchi key:
+
* transcription direction:
** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
+
** POSITIVE
* common name:
+
* right end position:
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
+
** 16519
* molecular weight:
+
* centisome position:
** 223.234    
+
** 86.91133    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-15733]]
+
* [[3.5.1.98-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=14801}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: right end position=16519}}
{{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}}
+
{{#set: centisome position=86.91133   }}
{{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
+
{{#set: reaction associated=3.5.1.98-RXN}}
{{#set: molecular weight=223.234   }}
+
{{#set: consumed by=RXN-15733}}
+

Revision as of 00:16, 19 March 2018

Gene Tiso_gene_3315

  • left end position:
    • 14801
  • transcription direction:
    • POSITIVE
  • right end position:
    • 16519
  • centisome position:
    • 86.91133
  • Synonym(s):

Reactions associated

Pathways associated

External links