Difference between revisions of "PWY-1269"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14047 RXN-14047] == * direction: ** REVERSIBLE * common name: ** Aconitate hydratase 2 (Aconita...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * common name: ** 4-methylp...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) |
* common name: | * common name: | ||
| − | ** | + | ** 4-methylphenyl sulfate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M |
| + | * molecular weight: | ||
| + | ** 187.19 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** p-cresol sulfate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-15588]] | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4615422 4615422] |
| − | + | * CHEMSPIDER: | |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.3806481.html 3806481] |
| − | + | * HMDB : HMDB11635 | |
| − | {{#set: | + | {{#set: smiles=CC1(C=CC(=CC=1)OS(=O)(=O)[O-])}} |
| − | {{#set: | + | {{#set: common name=4-methylphenyl sulfate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=187.19 }} |
| − | {{#set: | + | {{#set: common name=p-cresol sulfate}} |
| + | {{#set: reversible reaction associated=RXN-15588}} | ||
Revision as of 14:44, 21 March 2018
Contents
Metabolite CPD-16819
- smiles:
- CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
- common name:
- 4-methylphenyl sulfate
- inchi key:
- InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
- molecular weight:
- 187.19
- Synonym(s):
- p-cresol sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C=CC(=CC=1)OS(=O)(=O)[O-])" cannot be used as a page name in this wiki.
