Difference between revisions of "Tiso gene 18552"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Gene == Gene Tiso_gene_16538 == * right end position: ** 3667 * transcription direction: ** POSITIVE * left end position: ** 362 * centisome position: ** 8.424482...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16538 == |
− | * | + | * right end position: |
− | ** | + | ** 3667 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 362 |
− | * | + | * centisome position: |
− | ** | + | ** 8.424482 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.4.2.31-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3667}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=362}} | |
− | + | {{#set: centisome position=8.424482 }} | |
− | + | {{#set: reaction associated=2.4.2.31-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 14:44, 21 March 2018
Gene Tiso_gene_16538
- right end position:
- 3667
- transcription direction:
- POSITIVE
- left end position:
- 362
- centisome position:
- 8.424482
- Synonym(s):
Reactions associated
- Reaction: 2.4.2.31-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation