Difference between revisions of "3.4.23.1-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.213-RXN 2.4.1.213-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.or...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.213-RXN 2.4.1.213-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.213 EC-2.4.1.213] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[ADP-D-GLUCOSE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[CPD-18011]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 sn-glycerol 3-phosphate[c] '''+''' 1 ADP-α-D-glucose[c] '''<=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18196]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Gene: [[Tiso_gene_6869]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Gene: [[Tiso_gene_14220]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12881 12881] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05328 R05328] | |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.4.1.213}} |
− | + | {{#set: gene associated=Tiso_gene_18196|Tiso_gene_6869|Tiso_gene_14220}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-synechocystis}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:44, 21 March 2018
Contents
Reaction 2.4.1.213-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GLYCEROL-3P[c] + 1 ADP-D-GLUCOSE[c] <=> 1 PROTON[c] + 1 ADP[c] + 1 CPD-18011[c]
- With common name(s):
- 1 sn-glycerol 3-phosphate[c] + 1 ADP-α-D-glucose[c] <=> 1 H+[c] + 1 ADP[c] + 1 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18196
- Source: orthology-synechocystis
- Gene: Tiso_gene_6869
- Source: orthology-synechocystis
- Gene: Tiso_gene_14220
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
External links