Difference between revisions of "RXN0-5265"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10960 RXN-10960] == * direction: ** LEFT-TO-RIGHT * common name: ** inositol3 ** type_i_inosito...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINATE_NUCLEOTIDE NICOTINATE_NUCLEOTIDE] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINATE_NUCLEOTIDE NICOTINATE_NUCLEOTIDE] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) |
* common name: | * common name: | ||
− | ** | + | ** β-nicotinate D-ribonucleotide |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=JOUIQRNQJGXQDC-ZYUZMQFOSA-L |
− | ** | + | * molecular weight: |
+ | ** 333.191 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** nicotinate dinucleotide | ||
+ | ** β-nicotinate-D-nucleotide | ||
+ | ** NaMN | ||
+ | ** nicotinic acid nucleotide | ||
+ | ** nicotinic acid mononucleotide | ||
+ | ** nicotinic acid ribonucleotide | ||
+ | ** nicotinate-D-ribonucleotide | ||
+ | ** nicotinate ribonucleotide | ||
+ | ** nicotinate nucleotide | ||
+ | ** deamido-nicotinamide mononucleotide | ||
+ | ** deamido-NMN | ||
+ | ** nicotinate D-ribonucleotide | ||
+ | ** nicotinate mononucleotide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[NICONUCADENYLYLTRAN-RXN]] |
− | + | * [[RXN-14227]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-8443]] | |
− | + | * [[DNNH]] | |
− | == | + | * [[QUINOPRIBOTRANS-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[NRPH]] |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * CAS : 321-02-8 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * BIGG : nicrnt |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878382 46878382] |
− | {{#set: | + | * HMDB : HMDB01132 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01185 C01185] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57502 57502] |
− | + | * METABOLIGHTS : MTBLC57502 | |
− | {{#set: | + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))}} |
+ | {{#set: common name=β-nicotinate D-ribonucleotide}} | ||
+ | {{#set: inchi key=InChIKey=JOUIQRNQJGXQDC-ZYUZMQFOSA-L}} | ||
+ | {{#set: molecular weight=333.191 }} | ||
+ | {{#set: common name=nicotinate dinucleotide|β-nicotinate-D-nucleotide|NaMN|nicotinic acid nucleotide|nicotinic acid mononucleotide|nicotinic acid ribonucleotide|nicotinate-D-ribonucleotide|nicotinate ribonucleotide|nicotinate nucleotide|deamido-nicotinamide mononucleotide|deamido-NMN|nicotinate D-ribonucleotide|nicotinate mononucleotide}} | ||
+ | {{#set: consumed by=NICONUCADENYLYLTRAN-RXN|RXN-14227}} | ||
+ | {{#set: produced by=RXN-8443|DNNH|QUINOPRIBOTRANS-RXN}} | ||
+ | {{#set: reversible reaction associated=NRPH}} |
Revision as of 14:44, 21 March 2018
Contents
Metabolite NICOTINATE_NUCLEOTIDE
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))
- common name:
- β-nicotinate D-ribonucleotide
- inchi key:
- InChIKey=JOUIQRNQJGXQDC-ZYUZMQFOSA-L
- molecular weight:
- 333.191
- Synonym(s):
- nicotinate dinucleotide
- β-nicotinate-D-nucleotide
- NaMN
- nicotinic acid nucleotide
- nicotinic acid mononucleotide
- nicotinic acid ribonucleotide
- nicotinate-D-ribonucleotide
- nicotinate ribonucleotide
- nicotinate nucleotide
- deamido-nicotinamide mononucleotide
- deamido-NMN
- nicotinate D-ribonucleotide
- nicotinate mononucleotide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 321-02-8
- BIGG : nicrnt
- PUBCHEM:
- HMDB : HMDB01132
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57502
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))" cannot be used as a page name in this wiki.