Difference between revisions of "Tiso gene 1983"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
(Created page with "Category:Gene == Gene Tiso_gene_1983 == * right end position: ** 19425 * transcription direction: ** POSITIVE * left end position: ** 4053 * centisome position: ** 19.3867...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] ==
+
== Gene Tiso_gene_1983 ==
* smiles:
+
* right end position:
** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** 19425
* inchi key:
+
* transcription direction:
** InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J
+
** POSITIVE
* common name:
+
* left end position:
** (S)-3-hydroxydecanoyl-CoA
+
** 4053
* molecular weight:
+
* centisome position:
** 933.753    
+
** 19.386778    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12490]]
+
* Reaction: [[ATPASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-13616]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: right end position=19425}}
** [http://www.genome.jp/dbget-bin/www_bget?C05264 C05264]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=4053}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62616 62616]
+
{{#set: centisome position=19.386778   }}
* BIGG : 3hdcoa
+
{{#set: reaction associated=ATPASE-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859629 49859629]
+
* HMDB : HMDB03938
+
{{#set: smiles=CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(OC(C(C1OP([O-])(=O)[O-])O)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: inchi key=InChIKey=HIVSMYZAMUNFKZ-PNPVFPMQSA-J}}
+
{{#set: common name=(S)-3-hydroxydecanoyl-CoA}}
+
{{#set: molecular weight=933.753   }}
+
{{#set: consumed by=RXN-12490}}
+
{{#set: produced by=RXN-13616}}
+

Revision as of 14:45, 21 March 2018

Gene Tiso_gene_1983

  • right end position:
    • 19425
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4053
  • centisome position:
    • 19.386778
  • Synonym(s):

Reactions associated

Pathways associated

External links