Difference between revisions of "FLAVONADPREDUCT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-171 RXN-171] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-171 RXN-171] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
+
** dioleoyl phosphatidate
 +
* inchi key:
 +
** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
 +
* molecular weight:
 +
** 698.959   
 
* Synonym(s):
 
* Synonym(s):
 +
** 18:1-18:1-PA
 +
** 1-18:1-2-18:1-phosphatidic acid
 +
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
 +
** 1-18:1-2-18:1-phosphatidate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15068]]
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-134]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CPD-482]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-15043]]
−
** 1 oxygen[c] '''+''' 1 gibberellin A9[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 CO2[c] '''+''' 1 succinate[c] '''+''' 1 gibberellin A51[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3330]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-102]], gibberellin inactivation I (2β-hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-102 PWY-102]
+
−
** '''4''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06337 R06337]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627209 71627209]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-1.14.11}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308]
−
{{#set: gene associated=Tiso_gene_3330}}
+
* HMDB : HMDB07865
−
{{#set: in pathway=PWY-102}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=dioleoyl phosphatidate}}
−
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
{{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=698.959    }}
 +
{{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}}
 +
{{#set: consumed by=RXN-15068}}
 +
{{#set: produced by=RXN-15043}}

Revision as of 14:45, 21 March 2018

Metabolite CPD-8268

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
  • common name:
    • dioleoyl phosphatidate
  • inchi key:
    • InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
  • molecular weight:
    • 698.959
  • Synonym(s):
    • 18:1-18:1-PA
    • 1-18:1-2-18:1-phosphatidic acid
    • 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
    • 1-18:1-2-18:1-phosphatidate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=FLAVONADPREDUCT-RXN&oldid=29922"