Difference between revisions of "GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-2-Hydroxyacids1 S-2-Hydroxyacids1] == * common name: ** an (S)-2-hydroxyacid * Synonym(s): =...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-2-Hydroxyacids1 S-2-Hydroxyacids1] ==
−
* smiles:
+
−
** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
+
−
* inchi key:
+
−
** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
+
 
* common name:
 
* common name:
−
** tetrahydropteroyl tri-L-glutamate
+
** an (S)-2-hydroxyacid
−
* molecular weight:
+
−
** 699.633   
+
 
* Synonym(s):
 
* Synonym(s):
−
** H4PteGlu3
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[HOMOCYSMET-RXN]]
+
* [[3.8.1.11-RXN]]
 +
* [[RXN-6264]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an (S)-2-hydroxyacid}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999]
+
{{#set: reversible reaction associated=3.8.1.11-RXN|RXN-6264}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144]
+
−
* HMDB : HMDB12290
+
−
{{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}}
+
−
{{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}}
+
−
{{#set: common name=tetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: molecular weight=699.633    }}
+
−
{{#set: common name=H4PteGlu3}}
+
−
{{#set: reversible reaction associated=HOMOCYSMET-RXN}}
+

Revision as of 15:46, 21 March 2018

Metabolite S-2-Hydroxyacids1

  • common name:
    • an (S)-2-hydroxyacid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN&oldid=30094"