Difference between revisions of "M5TAP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-ALA-PWY GLYSYN-ALA-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* common name: | * common name: | ||
− | ** | + | ** glycine biosynthesis III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
− | + | * [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]] | |
− | * [[ | + | ** 3 associated gene(s): |
+ | *** [[Tiso_gene_6134]] | ||
+ | *** [[Tiso_gene_5726]] | ||
+ | *** [[Tiso_gene_11231]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=glycine biosynthesis III}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=1}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:47, 21 March 2018
Pathway GLYSYN-ALA-PWY
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN
- 3 associated gene(s):
- 5 reconstruction source(s) associated: