Difference between revisions of "PWY-7343"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TA...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * common name: ** L-cana...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
+
 
* common name:
 
* common name:
−
** L-tryptophan biosynthesis
+
** L-canavanine
 +
* inchi key:
 +
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
 +
* molecular weight:
 +
** 177.183   
 
* Synonym(s):
 
* Synonym(s):
 +
** canavanine
 +
** 2-amino-4-(guanidinooxy)butyrate
 +
** 2-amino-4-(guanidinooxy)butyric acid
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''6''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[ANTHRANSYN-RXN]]
+
* [[RXN-22]]
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_11176]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[IGPSYN-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Tiso_gene_4521]]
+
−
*** [[Tiso_gene_18384]]
+
−
*** [[Tiso_gene_10298]]
+
−
*** [[Tiso_gene_10297]]
+
−
** 6 reconstruction source(s) associated:
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[PRAISOM-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_10297]]
+
−
*** [[Tiso_gene_10298]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[PRTRANS-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_15839]]
+
−
** 7 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[manual-primary_network]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[RXN0-2381]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_17207]]
+
−
*** [[Tiso_gene_4604]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN0-2382]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_17207]]
+
−
*** [[Tiso_gene_4604]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* CAS : 543-38-4
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY]
+
* PUBCHEM:
−
* ARACYC:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY]
+
* HMDB : HMDB02706
−
{{#set: taxonomic range=TAX-4751}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-2157}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
−
{{#set: taxonomic range=TAX-2}}
+
* LIGAND-CPD:
−
{{#set: taxonomic range=TAX-3193}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
−
{{#set: common name=L-tryptophan biosynthesis}}
+
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
−
{{#set: reaction found=6}}
+
{{#set: common name=L-canavanine}}
−
{{#set: total reaction=6}}
+
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
−
{{#set: completion rate=100.0}}
+
{{#set: molecular weight=177.183    }}
 +
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
 +
{{#set: produced by=RXN-22}}

Revision as of 14:47, 21 March 2018

Metabolite CANAVANINE

  • smiles:
    • C(CC([N+])C(=O)[O-])ONC(=[N+])N
  • common name:
    • L-canavanine
  • inchi key:
    • InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
  • molecular weight:
    • 177.183
  • Synonym(s):
    • canavanine
    • 2-amino-4-(guanidinooxy)butyrate
    • 2-amino-4-(guanidinooxy)butyric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7343&oldid=30169"