Difference between revisions of "Tiso gene 5462"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Tiso_gene_11478 == * right end position: ** 7258 * transcription direction: ** POSITIVE * left end position: ** 3970 * centisome position: ** 51.0348...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Gene Tiso_gene_11478 ==
−
* smiles:
+
* right end position:
−
** C(=CC1(=CC=C(O)C=C1))CO
+
** 7258
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 4-coumaryl alcohol
+
** 3970
−
* molecular weight:
+
* centisome position:
−
** 150.177    
+
** 51.03484    
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaryl alcohol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-12587]]
−
* [[RXN-1102]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-12588]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14382]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14384]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14385]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14386]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15881]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9787]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-308]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY0-1021]]
 +
* [[PWY-6823]]
 +
* [[PWY-7250]]
 +
* [[PWY-6892]]
 +
* [[PWY-6891]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=7258}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=3970}}
−
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
{{#set: centisome position=51.03484   }}
−
* CHEBI:
+
{{#set: reaction associated=RXN-12587|RXN-12588|RXN-14382|RXN-14384|RXN-14385|RXN-14386|RXN-15881|RXN-9787|RXN0-308}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
{{#set: pathway associated=PWY0-1021|PWY-6823|PWY-7250|PWY-6892|PWY-6891}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
−
* HMDB : HMDB03654
+
−
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
−
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
−
{{#set: common name=4-coumaryl alcohol}}
+
−
{{#set: molecular weight=150.177   }}
+
−
{{#set: common name=p-coumaryl alcohol}}
+
−
{{#set: produced by=RXN-1102}}
+

Revision as of 14:49, 21 March 2018

Gene Tiso_gene_11478

  • right end position:
    • 7258
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3970
  • centisome position:
    • 51.03484
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5462&oldid=30440"