Difference between revisions of "RXN-12876"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methyl-Jasmonates Methyl-Jasmonates] == * common name: ** a methyl jasmonate * Synonym(s): ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * com...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) | ||
* common name: | * common name: | ||
| − | ** | + | ** shikimate 3-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K | ||
| + | * molecular weight: | ||
| + | ** 251.109 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** shikimate 5-phosphate |
| − | ** | + | ** shikimate-5-P |
| − | ** | + | ** 3-phosphoshikimate |
| + | ** shikimate-3-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.5.1.19-RXN]] | ||
| + | * [[SHIKIMATE-KINASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989] | ||
| + | * BIGG : skm5p | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175] | ||
| + | {{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}} | ||
| + | {{#set: common name=shikimate 3-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}} | ||
| + | {{#set: molecular weight=251.109 }} | ||
| + | {{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}} | ||
| + | {{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}} | ||
Revision as of 14:49, 21 March 2018
Contents
Metabolite SHIKIMATE-5P
- smiles:
- C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
- common name:
- shikimate 3-phosphate
- inchi key:
- InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
- molecular weight:
- 251.109
- Synonym(s):
- shikimate 5-phosphate
- shikimate-5-P
- 3-phosphoshikimate
- shikimate-3-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.
