Difference between revisions of "RXN-17127"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6405 PWY-6405] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-8782 TAX-87...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6405 PWY-6405] ==
* smiles:
+
* taxonomic range:
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-8782 TAX-8782]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33083 TAX-33083]
 
* common name:
 
* common name:
** 4-amino-4-deoxychorismate
+
** Rapoport-Luebering glycolytic shunt
* molecular weight:
+
** 224.193   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-15511]]
* [[ADCLY-RXN]]
+
** 8 associated gene(s):
* [[PABASYN-RXN]]
+
*** [[Tiso_gene_2365]]
 +
*** [[Tiso_gene_2841]]
 +
*** [[Tiso_gene_9923]]
 +
*** [[Tiso_gene_7201]]
 +
*** [[Tiso_gene_9922]]
 +
*** [[Tiso_gene_16271]]
 +
*** [[Tiso_gene_14530]]
 +
*** [[Tiso_gene_14664]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BISPHOSPHOGLYCERATE-MUTASE-RXN BISPHOSPHOGLYCERATE-MUTASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11102 RXN-11102]
 
== External links  ==
 
== External links  ==
* CAS : 97279-79-3
+
{{#set: taxonomic range=TAX-8782}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-40674}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632]
+
{{#set: taxonomic range=TAX-33083}}
* CHEBI:
+
{{#set: common name=Rapoport-Luebering glycolytic shunt}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406]
+
{{#set: reaction found=1}}
* BIGG : 4adcho
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355]
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}}
+
{{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}}
+
{{#set: common name=4-amino-4-deoxychorismate}}
+
{{#set: molecular weight=224.193    }}
+
{{#set: reversible reaction associated=ADCLY-RXN|PABASYN-RXN}}
+

Revision as of 15:50, 21 March 2018

Pathway PWY-6405

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links