Difference between revisions of "CPD1G-771"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME255 RME255] == * direction: ** LEFT-TO-RIGHT * common name: ** RME255 * Synonym(s): == Reaction...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME255 RME255] ==
−
* smiles:
+
* direction:
−
** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J
+
 
* common name:
 
* common name:
−
** 3R-hydroxy-lesqueroloyl-CoA
+
** RME255
−
* molecular weight:
+
−
** 1088.005   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14493]]
+
** 0.18 [[TTP]][c] '''+''' 0.32 [[DGTP]][c] '''+''' 0.32 [[DCTP]][c] '''+''' 1.372 [[ATP]][c] '''+''' 0.18 [[DATP]][c] '''+''' 2.372 [[WATER]][c] '''=>''' 1.372 [[Pi]][c] '''+''' 1.372 [[ADP]][c] '''+''' 2.372 [[PROTON]][c] '''+''' 1.0 [[PPI]][c] '''+''' 1.0 [[DNA-Holder]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 0.18 dTTP[c] '''+''' 0.32 dGTP[c] '''+''' 0.32 dCTP[c] '''+''' 1.372 ATP[c] '''+''' 0.18 dATP[c] '''+''' 2.372 H2O[c] '''=>''' 1.372 phosphate[c] '''+''' 1.372 ADP[c] '''+''' 2.372 H+[c] '''+''' 1.0 diphosphate[c] '''+''' 1.0 DNA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819813 91819813]
+
{{#set: common name=RME255}}
−
{{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J}}
+
{{#set: reconstruction category=manual}}
−
{{#set: common name=3R-hydroxy-lesqueroloyl-CoA}}
+
{{#set: reconstruction source=manual-primary_network}}
−
{{#set: molecular weight=1088.005    }}
+
−
{{#set: produced by=RXN-14493}}
+

Revision as of 14:50, 21 March 2018

Reaction RME255

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • RME255
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 0.18 dTTP[c] + 0.32 dGTP[c] + 0.32 dCTP[c] + 1.372 ATP[c] + 0.18 dATP[c] + 2.372 H2O[c] => 1.372 phosphate[c] + 1.372 ADP[c] + 2.372 H+[c] + 1.0 diphosphate[c] + 1.0 DNA[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1G-771&oldid=30621"