Difference between revisions of "4OH2OXOGLUTARALDOL-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == * smiles: ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O * inchi key: ** InChIKey=VBUYCZ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(C(C(C(CO)O)O)O)=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M
+
 
* common name:
 
* common name:
−
** 2-keto-D-gluconate
+
** mevalonate pathway II (archaea)
−
* molecular weight:
+
−
** 193.133   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-dehydro-D-gluconate
+
** isoprenoid pathway
 +
** MVA pathway
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[1.1.1.34-RXN]]
−
* [[1.1.1.274-RXN]]
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_16182]]
 +
*** [[Tiso_gene_17889]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_16181]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_17451]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_9236]]
 +
*** [[Tiso_gene_14303]]
 +
*** [[Tiso_gene_8563]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[IPPISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8653]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3811]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10067 RXN-10067]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10068 RXN-10068]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06473 C06473]
+
{{#set: common name=mevalonate pathway II (archaea)}}
−
* CHEMSPIDER:
+
{{#set: common name=isoprenoid pathway|MVA pathway}}
−
** [http://www.chemspider.com/Chemical-Structure.5256721.html 5256721]
+
{{#set: reaction found=5}}
−
* CHEBI:
+
{{#set: total reaction=7}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16808 16808]
+
{{#set: completion rate=71.0}}
−
* BIGG : 2dhglcn
+
−
* BIGG : 2dhguln
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857381 6857381]
+
−
{{#set: smiles=C(C(C(C(C(CO)O)O)O)=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M}}
+
−
{{#set: common name=2-keto-D-gluconate}}
+
−
{{#set: molecular weight=193.133    }}
+
−
{{#set: common name=2-dehydro-D-gluconate}}
+
−
{{#set: reversible reaction associated=1.1.1.274-RXN}}
+

Revision as of 14:51, 21 March 2018

Pathway PWY-6174

  • taxonomic range:
  • common name:
    • mevalonate pathway II (archaea)
  • Synonym(s):
    • isoprenoid pathway
    • MVA pathway

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=4OH2OXOGLUTARALDOL-RXN&oldid=30704"