Difference between revisions of "Tiso gene 14026"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cyclic-3-5-Nucleoside-Monophosphates Cyclic-3-5-Nucleoside-Monophosphates] == * common name: **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cyclic-3-5-Nucleoside-Monophosphates Cyclic-3-5-Nucleoside-Monophosphates] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
 +
* smiles:
 +
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
 
* common name:
 
* common name:
** a nucleoside cyclic 3',5'-monophosphate
+
** 8-oxo-GTP
 +
* inchi key:
 +
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
 +
* molecular weight:
 +
** 535.151   
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-guanosine-triphosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.4.17-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11409]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a nucleoside cyclic 3',5'-monophosphate}}
+
* PUBCHEM:
{{#set: consumed by=3.1.4.17-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
 +
{{#set: common name=8-oxo-GTP}}
 +
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
 +
{{#set: molecular weight=535.151    }}
 +
{{#set: common name=8-oxo-guanosine-triphosphate}}
 +
{{#set: produced by=RXN-11409}}

Revision as of 15:51, 21 March 2018

Metabolite CPD-12366

  • smiles:
    • C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • common name:
    • 8-oxo-GTP
  • inchi key:
    • InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
  • molecular weight:
    • 535.151
  • Synonym(s):
    • 8-oxo-guanosine-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.