Difference between revisions of "PHOSPHORIBOSYL-FORMIMINO-AICAR-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCAA-dehydrogenase-2MP-DH-lipoyl BCAA-dehydrogenase-2MP-DH-lipoyl] == * common name: ** an [apo...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCAA-dehydrogenase-2MP-DH-lipoyl BCAA-dehydrogenase-2MP-DH-lipoyl] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylpropanoyl]dihydrolipoyl-L-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** [enzyme] N6-(S-[2-methylpropanoyl]dihydrolipoyl)lysine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[1.2.4.4-RXN]] |
| − | * [[ | + | * [[2.3.1.168-RXN]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylpropanoyl]dihydrolipoyl-L-lysine}} | |
| − | + | {{#set: common name=[enzyme] N6-(S-[2-methylpropanoyl]dihydrolipoyl)lysine}} | |
| − | + | {{#set: reversible reaction associated=1.2.4.4-RXN|2.3.1.168-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: reversible reaction associated= | + | |
Revision as of 14:51, 21 March 2018
Contents
Metabolite BCAA-dehydrogenase-2MP-DH-lipoyl
- common name:
- an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylpropanoyl]dihydrolipoyl-L-lysine
- Synonym(s):
- [enzyme] N6-(S-[2-methylpropanoyl]dihydrolipoyl)lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylpropanoyl]dihydrolipoyl-L-lysine" cannot be used as a page name in this wiki.
"enzyme] N6-(S-[2-methylpropanoyl]dihydrolipoyl)lysine" cannot be used as a page name in this wiki.
