Difference between revisions of "PWY-7765"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2804 == * left end position: ** 2856 * transcription direction: ** POSITIVE * right end position: ** 5200 * centisome position: ** 15.53017...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)N...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** trans-2,3-dehydroadipyl-coA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I |
| − | * | + | * molecular weight: |
| − | ** | + | ** 888.606 |
* Synonym(s): | * Synonym(s): | ||
| + | ** cis-2,3-didehydroadipyl-CoA | ||
| + | ** 2,3-didehydroadipyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-2425]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679154 70679154] |
| − | {{#set: | + | * HMDB : HMDB60392 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71044 71044] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C14144 C14144] | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: common name=trans-2,3-dehydroadipyl-coA}} | ||
| + | {{#set: inchi key=InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I}} | ||
| + | {{#set: molecular weight=888.606 }} | ||
| + | {{#set: common name=cis-2,3-didehydroadipyl-CoA|2,3-didehydroadipyl-CoA}} | ||
| + | {{#set: reversible reaction associated=RXN-2425}} | ||
Revision as of 14:53, 21 March 2018
Contents
Metabolite TRANS-23-DEHYDROADIPYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- trans-2,3-dehydroadipyl-coA
- inchi key:
- InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I
- molecular weight:
- 888.606
- Synonym(s):
- cis-2,3-didehydroadipyl-CoA
- 2,3-didehydroadipyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
