Difference between revisions of "Tiso gene 13521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * common name: ** coumarinate...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C(C=CC1(=C(C=CC=C1)O))(=O)[O-]
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** pyruvate fermentation to butanol II (engineered)
+
** coumarinate
 +
* inchi key:
 +
** InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M
 +
* molecular weight:
 +
** 163.152   
 
* Synonym(s):
 
* Synonym(s):
** 1-butanol synthesis
+
** coumarinic acid
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''4''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-8037]]
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
== Reaction(s) known to produce the compound ==
** 3 associated gene(s):
+
* [[RXN-8036]]
*** [[Tiso_gene_16181]]
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_15327]]
+
*** [[Tiso_gene_17451]]
+
** 4 reconstruction source(s) associated:
+
*** [[orthology-athaliana]]
+
*** [[orthology-creinhardtii]]
+
*** [[orthology-synechocystis]]
+
*** [[orthology-esiliculosus]]
+
* [[RXN-11662]]
+
** 7 associated gene(s):
+
*** [[Tiso_gene_5857]]
+
*** [[Tiso_gene_16703]]
+
*** [[Tiso_gene_14027]]
+
*** [[Tiso_gene_14262]]
+
*** [[Tiso_gene_14026]]
+
*** [[Tiso_gene_18838]]
+
*** [[Tiso_gene_18839]]
+
** 5 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-creinhardtii]]
+
*** [[orthology-esiliculosus]]
+
* [[RXN-11667]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_5857]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-athaliana]]
+
* [[RXN-161]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=BUTANAL-DEHYDROGENASE-RXN BUTANAL-DEHYDROGENASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12558 RXN-12558]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54714352 54714352]
{{#set: common name=pyruvate fermentation to butanol II (engineered)}}
+
* HMDB : HMDB41592
{{#set: common name=1-butanol synthesis}}
+
* LIGAND-CPD:
{{#set: reaction found=4}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05838 C05838]
{{#set: total reaction=6}}
+
* CHEMSPIDER:
{{#set: completion rate=67.0}}
+
** [http://www.chemspider.com/Chemical-Structure.20118034.html 20118034]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47921 47921]
 +
* METABOLIGHTS : MTBLC47921
 +
{{#set: smiles=C(C=CC1(=C(C=CC=C1)O))(=O)[O-]}}
 +
{{#set: common name=coumarinate}}
 +
{{#set: inchi key=InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M}}
 +
{{#set: molecular weight=163.152    }}
 +
{{#set: common name=coumarinic acid}}
 +
{{#set: consumed by=RXN-8037}}
 +
{{#set: produced by=RXN-8036}}

Revision as of 14:53, 21 March 2018

Metabolite CPD-7418

  • smiles:
    • C(C=CC1(=C(C=CC=C1)O))(=O)[O-]
  • common name:
    • coumarinate
  • inchi key:
    • InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M
  • molecular weight:
    • 163.152
  • Synonym(s):
    • coumarinic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C=CC1(=C(C=CC=C1)O))(=O)[O-" cannot be used as a page name in this wiki.