Difference between revisions of "ExchangeSeed WATER"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11002 RXN-11002] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11002 RXN-11002] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.1.1.co EC-1.1.1.co] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[SUCC-S-ALD]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[4-HYDROXY-BUTYRATE]][c] '''+''' 1 [[NADP]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 succinate semialdehyde[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 4-hydroxybutanoate[c] '''+''' 1 NADP+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-5789]], 3-hydroxypropanoate/4-hydroxybutanate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5789 PWY-5789] | ||
+ | ** '''8''' reactions found over '''16''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26384 26384] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R09281 R09281] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-1.1.1.co}} |
− | {{#set: | + | {{#set: in pathway=PWY-5789}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 14:53, 21 March 2018
Contents
Reaction RXN-11002
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 SUCC-S-ALD[c] + 1 NADPH[c] + 1 PROTON[c] => 1 4-HYDROXY-BUTYRATE[c] + 1 NADP[c]
- With common name(s):
- 1 succinate semialdehyde[c] + 1 NADPH[c] + 1 H+[c] => 1 4-hydroxybutanoate[c] + 1 NADP+[c]
Genes associated with this reaction
Pathways
- PWY-5789, 3-hydroxypropanoate/4-hydroxybutanate cycle: PWY-5789
- 8 reactions found over 16 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links