Difference between revisions of "Tiso gene 5008"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_18843 == * left end position: ** 7 * transcription direction: ** POSITIVE * right end position: ** 1237 * centisome position: ** 0.25343955...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * c...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_18843 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] ==
−
* left end position:
+
* smiles:
−
** 7
+
** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** mycophenolate
−
* right end position:
+
* inchi key:
−
** 1237
+
** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
−
* centisome position:
+
* molecular weight:
−
** 0.25343955    
+
** 319.333    
 
* Synonym(s):
 
* Synonym(s):
 +
** mycophenolic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.4.2.31-RXN]]
+
* [[RXN-13608]]
−
** in-silico_annotation
+
* [[RXN-13607]]
−
***ec-number
+
== Reaction(s) known to produce the compound ==
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=7}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995]
−
{{#set: right end position=1237}}
+
* CHEBI:
−
{{#set: centisome position=0.25343955   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932]
−
{{#set: reaction associated=2.4.2.31-RXN}}
+
{{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}}
 +
{{#set: common name=mycophenolate}}
 +
{{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}}
 +
{{#set: molecular weight=319.333   }}
 +
{{#set: common name=mycophenolic acid}}
 +
{{#set: consumed by=RXN-13608|RXN-13607}}

Revision as of 14:54, 21 March 2018

Metabolite CPD-14601

  • smiles:
    • CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
  • common name:
    • mycophenolate
  • inchi key:
    • InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
  • molecular weight:
    • 319.333
  • Synonym(s):
    • mycophenolic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5008&oldid=31069"