Difference between revisions of "Ubiquinols"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5135 PWY-5135] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3481 TAX-34...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O |
* common name: | * common name: | ||
| − | ** | + | ** bisorganyltrisulfane |
| + | * inchi key: | ||
| + | ** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L | ||
| + | * molecular weight: | ||
| + | ** 644.686 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** GS3G | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-10851]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371] |
| − | {{#set: | + | {{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}} |
| − | {{#set: | + | {{#set: common name=bisorganyltrisulfane}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}} |
| + | {{#set: molecular weight=644.686 }} | ||
| + | {{#set: common name=GS3G}} | ||
| + | {{#set: reversible reaction associated=RXN-10851}} | ||
Revision as of 14:54, 21 March 2018
Contents
Metabolite CPD-11763
- smiles:
- C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
- common name:
- bisorganyltrisulfane
- inchi key:
- InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
- molecular weight:
- 644.686
- Synonym(s):
- GS3G
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.
