Difference between revisions of "PYRAZIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * smiles: ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-2-enoyl-CoAs Cis-2-enoyl-CoAs] == * common name: ** a cis-2-enoyl-CoA * Synonym(s): == Rea...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-2-enoyl-CoAs Cis-2-enoyl-CoAs] ==
* smiles:
+
** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
+
* inchi key:
+
** InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
+
 
* common name:
 
* common name:
** violaxanthin
+
** a cis-2-enoyl-CoA
* molecular weight:
+
** 600.88   
+
 
* Synonym(s):
 
* Synonym(s):
** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7984]]
+
* [[RXN-7838]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7979]]
 
* [[RXN-13193]]
 
* [[ANXANor]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-13185]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-2-enoyl-CoA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438]
+
{{#set: consumed by=RXN-7838}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35288 35288]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614]
+
* HMDB : HMDB03101
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
+
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N}}
+
{{#set: common name=violaxanthin}}
+
{{#set: molecular weight=600.88    }}
+
{{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol}}
+
{{#set: consumed by=RXN-7984}}
+
{{#set: produced by=RXN-7979|RXN-13193|ANXANor}}
+
{{#set: reversible reaction associated=RXN-13185}}
+

Revision as of 15:56, 21 March 2018

Metabolite Cis-2-enoyl-CoAs

  • common name:
    • a cis-2-enoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links