Difference between revisions of "PWY-881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * inchi key: ** InChIKey=UH...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7498 PWY-7498] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7498 PWY-7498] ==
* smiles:
+
* taxonomic range:
** C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** thioguanine
+
** phenylpropanoids methylation (ice plant)
* molecular weight:
+
** 166.18   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-thioguanine
 
** 6-mercaptoguanine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''10''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
* [[TGUAt]]
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_10561]]
 +
*** [[Tiso_gene_14561]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-1104]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18971]]
 +
*** [[Tiso_gene_18257]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.88-RXN 2.1.1.88-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13900 RXN-13900]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15534 RXN-15534]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15536 RXN-15536]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15537 RXN-15537]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8262 RXN-8262]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8451 RXN-8451]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8452 RXN-8452]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB00352
+
{{#set: taxonomic range=TAX-33090}}
* LIGAND-CPD:
+
{{#set: common name=phenylpropanoids methylation (ice plant)}}
** [http://www.genome.jp/dbget-bin/www_bget?C07648 C07648]
+
{{#set: reaction found=2}}
* CHEBI:
+
{{#set: total reaction=10}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9555 9555]
+
{{#set: completion rate=20.0}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203152 25203152]
+
* HMDB : HMDB14496
+
{{#set: smiles=C1(N=C2(N=C(N)N=C([S-])C(N=1)2))}}
+
{{#set: inchi key=InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M}}
+
{{#set: common name=thioguanine}}
+
{{#set: molecular weight=166.18    }}
+
{{#set: common name=6-thioguanine|6-mercaptoguanine}}
+
{{#set: reversible reaction associated=TGUAt}}
+

Revision as of 15:56, 21 March 2018

Pathway PWY-7498

  • taxonomic range:
  • common name:
    • phenylpropanoids methylation (ice plant)
  • Synonym(s):

Reaction(s) found

2 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links