Difference between revisions of "Tiso gene 15329"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] == * smiles: ** C1(NC=C(CC(=O)[O-])N=1) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10915 RXN-10915] == * direction: ** REVERSIBLE * common name: ** 3,4-dihydroxyphenylglycol dehy...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-IMIDAZOLEACETATE 4-IMIDAZOLEACETATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10915 RXN-10915] ==
−
* smiles:
+
* direction:
−
** C1(NC=C(CC(=O)[O-])N=1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PRJKNHOMHKJCEJ-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 4-imidazoleacetate
+
** 3,4-dihydroxyphenylglycol dehydrogenase
−
* molecular weight:
+
** polyketide_synthase
−
** 125.107   
+
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1]
 
* Synonym(s):
 
* Synonym(s):
−
** imidazole-4-acetate
 
−
** imidazoleacetic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[ALDH_im4ac]]
+
** 1 [[CPD-11497]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-11876]][c]
−
* [[RXN-10089]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 3-methoxy-4-hydroxyphenylglycol[c] '''+''' 1 NAD+[c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 3-methoxy-4-hydroxyphenylglycolaldehyde[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7649]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5424]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6563]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6562]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5425]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6342]], noradrenaline and adrenaline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342]
 +
** '''2''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4139109 4139109]
+
{{#set: common name=3,4-dihydroxyphenylglycol dehydrogenase}}
−
* HMDB : HMDB02024
+
{{#set: common name=polyketide_synthase}}
−
* LIGAND-CPD:
+
{{#set: common name=ORF}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02835 C02835]
+
{{#set: ec number=EC-1.1.1.1}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_7649|Tiso_gene_5424|Tiso_gene_6563|Tiso_gene_6562|Tiso_gene_5425}}
−
** [http://www.chemspider.com/Chemical-Structure.3351679.html 3351679]
+
{{#set: in pathway=PWY-6342}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57969 57969]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* METABOLIGHTS : MTBLC57969
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C1(NC=C(CC(=O)[O-])N=1)}}
+
−
{{#set: inchi key=InChIKey=PRJKNHOMHKJCEJ-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-imidazoleacetate}}
+
−
{{#set: molecular weight=125.107    }}
+
−
{{#set: common name=imidazole-4-acetate|imidazoleacetic acid}}
+
−
{{#set: produced by=ALDH_im4ac|RXN-10089}}
+

Revision as of 14:56, 21 March 2018

Reaction RXN-10915

  • direction:
    • REVERSIBLE
  • common name:
    • 3,4-dihydroxyphenylglycol dehydrogenase
    • polyketide_synthase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-methoxy-4-hydroxyphenylglycol[c] + 1 NAD+[c] <=> 1 H+[c] + 1 NADH[c] + 1 3-methoxy-4-hydroxyphenylglycolaldehyde[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6342, noradrenaline and adrenaline degradation: PWY-6342
    • 2 reactions found over 13 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15329&oldid=31378"