Difference between revisions of "Tiso gene 12611"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15830 RXN-15830] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15830 RXN-15830] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 5-monophosphate
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 258.121   
+
** [http://enzyme.expasy.org/EC/1.9.3.1 EC-1.9.3.1]
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 5-monophosphate
 
−
** Ins(5)P1
 
−
** 1D-myo-inositol 5-phosphate
 
−
** Ins(5)P
 
−
** Ins5P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10953]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 4 [[Cytochromes-C-Reduced]][e] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 8 [[PROTON]][c] '''=>''' 4 [[Cytochromes-C-Oxidized]][e] '''+''' 4 [[PROTON]][e] '''+''' 2 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 4 a reduced c-type cytochrome[e] '''+''' 1 oxygen[c] '''+''' 8 H+[c] '''=>''' 4 an oxidized c-type cytochrome[e] '''+''' 4 H+[e] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15682]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18053]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_18580]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_7948]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6692]], Fe(II) oxidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6692 PWY-6692]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
+
{{#set: common name=ORF}}
−
{{#set: common name=1D-myo-inositol 5-monophosphate}}
+
{{#set: ec number=EC-1.9.3.1}}
−
{{#set: molecular weight=258.121    }}
+
{{#set: gene associated=Tiso_gene_15682|Tiso_gene_18053|Tiso_gene_18580|Tiso_gene_7948}}
−
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
+
{{#set: in pathway=PWY-6692}}
−
{{#set: consumed by=RXN-10953}}
+
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 14:57, 21 March 2018

Reaction RXN-15830

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6692, Fe(II) oxidation: PWY-6692
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12611&oldid=31392"