Difference between revisions of "PWY-699"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10769 RXN-10769] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** beta-glucosidase-lik...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * common name: ** 3,4-dihydroxybenz...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(C=C(C(=CC=1)O)O))=O |
* common name: | * common name: | ||
− | ** | + | ** 3,4-dihydroxybenzaldehyde |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N |
− | * | + | * molecular weight: |
− | + | ** 138.123 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** protocatechualdehyde | ||
+ | ** 3,4-dihydroxybenzyl aldehyde | ||
+ | ** rancinamycin IV | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8872]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768] | |
− | + | * CHEMSPIDER: | |
− | + | ** [http://www.chemspider.com/Chemical-Structure.8438.html 8438] | |
− | + | * HMDB : HMDB59965 | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700] |
− | {{#set: | + | {{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}} |
− | {{#set: | + | {{#set: common name=3,4-dihydroxybenzaldehyde}} |
+ | {{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=138.123 }} | ||
+ | {{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}} | ||
+ | {{#set: produced by=RXN-8872}} |
Revision as of 15:58, 21 March 2018
Contents
Metabolite CPD-7616
- smiles:
- C(C1(C=C(C(=CC=1)O)O))=O
- common name:
- 3,4-dihydroxybenzaldehyde
- inchi key:
- InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
- molecular weight:
- 138.123
- Synonym(s):
- protocatechualdehyde
- 3,4-dihydroxybenzyl aldehyde
- rancinamycin IV
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links