Difference between revisions of "Tiso gene 9035"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6722 PWY-6722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-18...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O))) |
* common name: | * common name: | ||
| − | ** | + | ** gibberellin A20 |
| + | * inchi key: | ||
| + | ** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M | ||
| + | * molecular weight: | ||
| + | ** 331.388 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** GA20 | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-113]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN1F-169]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035] | ||
| + | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
| + | {{#set: common name=gibberellin A20}} | ||
| + | {{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}} | ||
| + | {{#set: molecular weight=331.388 }} | ||
| + | {{#set: common name=GA20}} | ||
| + | {{#set: consumed by=RXN-113}} | ||
| + | {{#set: produced by=RXN1F-169}} | ||
Revision as of 14:58, 21 March 2018
Contents
Metabolite CPD1F-140
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A20
- inchi key:
- InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
- molecular weight:
- 331.388
- Synonym(s):
- GA20
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.
