Difference between revisions of "RXN0-2584"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-981 PWY0-981] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-981 PWY0-981] ==
* smiles:
+
* taxonomic range:
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
+
 
* common name:
 
* common name:
** cis-coumarinic acid-β-D-glucoside
+
** taurine degradation IV
* molecular weight:
+
** 325.294   
+
 
* Synonym(s):
 
* Synonym(s):
** coumarinic acid glucoside
 
** coumarinate glucoside
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-8036]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN0-299]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_17672]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* ECOCYC:
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-981 PWY0-981]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
+
{{#set: common name=taurine degradation IV}}
* PUBCHEM:
+
{{#set: reaction found=1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
+
{{#set: total reaction=1}}
* HMDB : HMDB60077
+
{{#set: completion rate=100.0}}
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
+
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
+
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
+
{{#set: molecular weight=325.294    }}
+
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
+
{{#set: consumed by=RXN-8036}}
+

Revision as of 15:58, 21 March 2018

Pathway PWY0-981

  • taxonomic range:
  • common name:
    • taurine degradation IV
  • Synonym(s):

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links