Difference between revisions of "RXN-14959"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7619 PWY-7619] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7619 PWY-7619] ==
* smiles:
+
* taxonomic range:
** C([O-])(=O)C1(=CC=CC(C1O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M
+
 
* common name:
 
* common name:
** (2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate
+
** juniperonate biosynthesis
* molecular weight:
+
** 155.13   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 5,11,14,17-icosatetraenoic acid biosynthesis
 +
** 5,11,14,17-icosatetraenoate biosynthesis
 +
** juniperonic acid biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[DHBDEHYD-RXN]]
+
'''4''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-12994]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_13083]]
 +
*** [[Tiso_gene_9871]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-12997]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-13001]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-13441]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11678 RXN-11678]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266758 45266758]
+
{{#set: common name=juniperonate biosynthesis}}
* CHEMSPIDER:
+
{{#set: common name=5,11,14,17-icosatetraenoic acid biosynthesis|5,11,14,17-icosatetraenoate biosynthesis|juniperonic acid biosynthesis}}
** [http://www.chemspider.com/Chemical-Structure.19951064.html 19951064]
+
{{#set: reaction found=4}}
* CHEBI:
+
{{#set: total reaction=5}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58764 58764]
+
{{#set: completion rate=80.0}}
* BIGG : 23ddhb
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04171 C04171]
+
{{#set: smiles=C([O-])(=O)C1(=CC=CC(C1O)O)}}
+
{{#set: inchi key=InChIKey=INCSWYKICIYAHB-WDSKDSINSA-M}}
+
{{#set: common name=(2S,3S)-2,3-dihydroxy-2,3-dihydrobenzoate}}
+
{{#set: molecular weight=155.13    }}
+
{{#set: consumed by=DHBDEHYD-RXN}}
+

Revision as of 15:58, 21 March 2018

Pathway PWY-7619

  • taxonomic range:
  • common name:
    • juniperonate biosynthesis
  • Synonym(s):
    • 5,11,14,17-icosatetraenoic acid biosynthesis
    • 5,11,14,17-icosatetraenoate biosynthesis
    • juniperonic acid biosynthesis

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links